0SX
8-chloro-2-[(2S)-pyrrolidin-2-yl][1]benzofuro[3,2-d]pyrimidin-4(3H)-one
Find entries where: 0SX
is present as a standalone ligand in 2 entries
Chemical Component Summary | |
|---|---|
| Name | 8-chloro-2-[(2S)-pyrrolidin-2-yl][1]benzofuro[3,2-d]pyrimidin-4(3H)-one |
| Identifiers | 8-chloranyl-2-[(2S)-pyrrolidin-2-yl]-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
| Formula | C14 H12 Cl N3 O2 |
| Molecular Weight | 289.717 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1cc2c(cc1Cl)c3c(o2)C(=O)NC(=N3)[C@@H]4CCCN4 |
| InChI | InChI=1S/C14H12ClN3O2/c15-7-3-4-10-8(6-7)11-12(20-10)14(19)18-13(17-11)9-2-1-5-16-9/h3-4,6,9,16H,1-2,5H2,(H,17,18,19)/t9-/m0/s1 |
| InChIKey | JJWLXRKVUJDJKG-VIFPVBQESA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 32 |
| Chiral Atom Count | 1 |
| Bond Count | 35 |
| Aromatic Bond Count | 10 |
Drug Info: DrugBank
| DrugBank ID | DB12357 |
|---|---|
| Name | BMS-863233 |
| Groups | investigational |
| Description | BMS-863233 has been investigated for the treatment of Refractory Hematologic Cancer. |
| Synonyms |
|
| CAS number | 1169558-38-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2030402 |
| PubChem | 57899889, 135564632 |
| ChEMBL | CHEMBL2030402 |
