Chemical Component Summary

Name(2E)-2-[({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methyl)imino]-4-(methylsulfanyl)butanoic acid
Identifiers(2E)-2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridin-4-yl]methylimino]-4-methylsulfanyl-butanoic acid
FormulaC13 H19 N2 O7 P S
Molecular Weight378.34
Isomeric SMILESCSCCC(=NCc1c(O)c(C)ncc1CO[P](O)(O)=O)C(O)=O

Chemical Details

Formal Charge0
Atom Count43
Chiral Atom Count0
Bond Count43
Aromatic Bond Count6