6LX
N-(3-aminopropyl)-N-[(1R)-1-(3-benzyl-7-chloro-4-oxo-4H-chromen-2-yl)-2-methylpropyl]-4-methylbenzamide
Find entries where: 6LX
is present as a standalone ligand in 2 entries
as a non-polymer is covalently linked to polymer or other heterogen groups 1 entries
Chemical Component Summary | |
|---|---|
| Name | N-(3-aminopropyl)-N-[(1R)-1-(3-benzyl-7-chloro-4-oxo-4H-chromen-2-yl)-2-methylpropyl]-4-methylbenzamide |
| Identifiers | N-(3-azanylpropyl)-N-[(1R)-1-[7-chloranyl-4-oxidanylidene-3-(phenylmethyl)chromen-2-yl]-2-methyl-propyl]-4-methyl-benzamide |
| Formula | C31 H33 Cl N2 O3 |
| Molecular Weight | 517.058 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1ccc(cc1)C(=O)N(CCCN)[C@@H](C2=C(C(=O)c3ccc(cc3O2)Cl)Cc4ccccc4)C(C)C |
| InChI | InChI=1S/C31H33ClN2O3/c1-20(2)28(34(17-7-16-33)31(36)23-12-10-21(3)11-13-23)30-26(18-22-8-5-4-6-9-22)29(35)25-15-14-24(32)19-27(25)37-30/h4-6,8-15,19-20,28H,7,16-18,33H2,1-3H3/t28-/m1/s1 |
| InChIKey | PGXYIBJJCLWJST-MUUNZHRXSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 70 |
| Chiral Atom Count | 1 |
| Bond Count | 73 |
| Aromatic Bond Count | 18 |
Drug Info: DrugBank
| DrugBank ID | DB05546 |
|---|---|
| Name | SB-743921 |
| Groups | investigational |
| Synonyms | SB-743921 |
| Indication | Investigated for use/treatment in cancer/tumors (unspecified) and lymphoma (non-hodgkin's). |
| Categories |
|
| CAS number | 618430-39-0 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2325429 |
| PubChem | 9936388 |
| ChEMBL | CHEMBL2325429 |
