949
4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxidanylidene-furan-2-yl]benzenesulfonamide
Find entries where: 949
is present as a standalone ligand in 2 entries
Chemical Component Summary | |
|---|---|
| Name | 4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxidanylidene-furan-2-yl]benzenesulfonamide |
| Synonyms | Polmacoxib |
| Identifiers | 4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxidanylidene-furan-2-yl]benzenesulfonamide |
| Formula | C18 H16 F N O4 S |
| Molecular Weight | 361.387 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC1(C(=O)C(=C(O1)c2ccc(cc2)S(=O)(=O)N)c3cccc(c3)F)C |
| InChI | InChI=1S/C18H16FNO4S/c1-18(2)17(21)15(12-4-3-5-13(19)10-12)16(24-18)11-6-8-14(9-7-11)25(20,22)23/h3-10H,1-2H3,(H2,20,22,23) |
| InChIKey | IJWPAFMIFNSIGD-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 41 |
| Chiral Atom Count | 0 |
| Bond Count | 43 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB12399 |
|---|---|
| Name | Polmacoxib |
| Groups | investigational |
| Description | Polmacoxib has been used in trials studying the treatment of Osteoarthritis, Osteoarthritis, Hip, Osteoarthritis, Knee, Localized Primary Osteoarthritis of Hip, and Localized Primary Osteoarthritis of Knee. |
| Synonyms | Polmacoxib |
| Categories |
|
| ATC-Code | M01AH07 |
| CAS number | 301692-76-2 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL166863 |
| PubChem | 9841854 |
| ChEMBL | CHEMBL166863 |
