Chemical Component Summary

Name3-[(2R)-2-borono-2-{[(thiophen-2-yl)acetyl]amino}ethyl]benzoic acid
Identifiers3-[(2~{R})-2-(dihydroxyboranyl)-2-(2-thiophen-2-ylethanoylamino)ethyl]benzoic acid
FormulaC15 H16 B N O5 S
Molecular Weight333.17
TypeNON-POLYMER
Isomeric SMILESOB(O)[C@H](Cc1cccc(c1)C(O)=O)NC(=O)Cc2sccc2
InChIInChI=1S/C15H16BNO5S/c18-14(9-12-5-2-6-23-12)17-13(16(21)22)8-10-3-1-4-11(7-10)15(19)20/h1-7,13,21-22H,8-9H2,(H,17,18)(H,19,20)/t13-/m0/s1
InChIKeySHAOGLYXUUWVRD-ZDUSSCGKSA-N

Chemical Details

Formal Charge0
Atom Count39
Chiral Atom Count1
Bond Count40
Aromatic Bond Count11