Chemical Component Summary

Name5-fluoranyl-2-methyl-benzoic acid
Identifiers5-fluoranyl-2-methyl-benzoic acid
FormulaC8 H7 F O2
Molecular Weight154.14
TypeNON-POLYMER
Isomeric SMILESCc1ccc(F)cc1C(O)=O
InChIInChI=1S/C8H7FO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11)
InChIKeyJVBLXLBINTYFPR-UHFFFAOYSA-N

Chemical Details

Formal Charge0
Atom Count18
Chiral Atom Count0
Bond Count18
Aromatic Bond Count6