B86
2'-deoxy-5-fluorocytidine
Find entries where: B86
is present as a standalone ligand in 1 entries
is present in a polymer sequence 2 entries
Chemical Component Summary | |
|---|---|
| Name | 2'-deoxy-5-fluorocytidine |
| Identifiers | 4-azanyl-5-fluoro-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| Formula | C9 H12 F N3 O4 |
| Molecular Weight | 245.208 |
| Type | NON-POLYMER |
| Isomeric SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=NC2=O)N)F)CO)O |
| InChI | InChI=1S/C9H12FN3O4/c10-4-2-13(9(16)12-8(4)11)7-1-5(15)6(3-14)17-7/h2,5-7,14-15H,1,3H2,(H2,11,12,16)/t5-,6+,7+/m0/s1 |
| InChIKey | IDYKCXHJJGMAEV-RRKCRQDMSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 29 |
| Chiral Atom Count | 3 |
| Bond Count | 30 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB12957 |
|---|---|
| Name | 5-fluoro-2'-deoxycytidine |
| Groups | investigational |
| Description | 5-fluoro-2'-deoxycytidine has been used in trials studying the treatment of Neoplasms, Lung Neoplasms, Breast Neoplasms, Head and Neck Neoplasms, and Urinary Bladder Neoplasms, among others. |
| Synonyms |
|
| Categories |
|
| CAS number | 10356-76-0 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 515328 |
| ChEMBL | CHEMBL1076257 |
