Chemical Component Summary

Name[3-(1-aminoisoquinolin-6-yl)phenyl]boronic acid
Identifiers[3-(1-azanylisoquinolin-6-yl)phenyl]boronic acid
FormulaC15 H13 B N2 O2
Molecular Weight264.09
TypeNON-POLYMER
Isomeric SMILESNc1nccc2cc(ccc12)c3cccc(c3)B(O)O
InChIInChI=1S/C15H13BN2O2/c17-15-14-5-4-11(8-12(14)6-7-18-15)10-2-1-3-13(9-10)16(19)20/h1-9,19-20H,(H2,17,18)
InChIKeyCCUGLTODPQTEBR-UHFFFAOYSA-N

Chemical Details

Formal Charge0
Atom Count33
Chiral Atom Count0
Bond Count35
Aromatic Bond Count17