Chemical Component Summary

NameN-(4-{[(2-amino-4-oxo-1,4-dihydroquinazolin-6-yl)methyl]amino}benzene-1-carbonyl)-D-glutamic acid
Identifiers(2~{R})-2-[[4-[(2-azanyl-4-oxidanylidene-1~{H}-quinazolin-6-yl)methylamino]phenyl]carbonylamino]pentanedioic acid
FormulaC21 H21 N5 O6
Molecular Weight439.42
TypeNON-POLYMER
Isomeric SMILESNC1=NC(=O)c2cc(CNc3ccc(cc3)C(=O)N[C@H](CCC(O)=O)C(O)=O)ccc2N1
InChIInChI=1S/C21H21N5O6/c22-21-25-15-6-1-11(9-14(15)19(30)26-21)10-23-13-4-2-12(3-5-13)18(29)24-16(20(31)32)7-8-17(27)28/h1-6,9,16,23H,7-8,10H2,(H,24,29)(H,27,28)(H,31,32)(H3,22,25,26,30)/t16-/m1/s1
InChIKeyUQFCLENKCDVITL-MRXNPFEDSA-N

Chemical Details

Formal Charge0
Atom Count53
Chiral Atom Count1
Bond Count55
Aromatic Bond Count12