Chemical Component Summary | |
|---|---|
| Name | S,3-HYDROXYBUTAN-2-ONE |
| Identifiers | (3S)-3-hydroxybutan-2-one |
| Formula | C4 H8 O2 |
| Molecular Weight | 88.105 |
| Type | NON-POLYMER |
| Isomeric SMILES | C[C@@H](C(=O)C)O |
| InChI | InChI=1S/C4H8O2/c1-3(5)4(2)6/h3,5H,1-2H3/t3-/m0/s1 |
| InChIKey | ROWKJAVDOGWPAT-VKHMYHEASA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 14 |
| Chiral Atom Count | 1 |
| Bond Count | 13 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB02788 |
|---|---|
| Name | (S)-acetoin |
| Groups | experimental |
| Description | A product of fermentation. It is a component of the butanediol cycle in microorganisms. In mammals it is oxidized to carbon dioxide. |
| Synonyms |
|
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 447765 |
| ChEBI | CHEBI:15687 |
