Chemical Component Summary

NameN-{[(1S)-5-({2-[2-(acetylamino)ethoxy]-4-bromobenzoyl}amino)-1-carboxypentyl]carbamoyl}-L-glutamic acid
Identifiers(2S)-2-[[(2S)-6-[[2-(2-acetamidoethoxy)-4-bromanyl-phenyl]carbonylamino]-1-oxidanyl-1-oxidanylidene-hexan-2-yl]carbamoylamino]pentanedioic acid
FormulaC23 H31 Br N4 O10
Molecular Weight603.42
TypeNON-POLYMER
Isomeric SMILESCC(=O)NCCOc1cc(Br)ccc1C(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(O)=O)C(O)=O)C(O)=O
InChIInChI=1S/C23H31BrN4O10/c1-13(29)25-10-11-38-18-12-14(24)5-6-15(18)20(32)26-9-3-2-4-16(21(33)34)27-23(37)28-17(22(35)36)7-8-19(30)31/h5-6,12,16-17H,2-4,7-11H2,1H3,(H,25,29)(H,26,32)(H,30,31)(H,33,34)(H,35,36)(H2,27,28,37)/t16-,17-/m0/s1
InChIKeyGEZLVAJRFLXCLD-IRXDYDNUSA-N

Chemical Details

Formal Charge0
Atom Count69
Chiral Atom Count2
Bond Count69
Aromatic Bond Count6