LWJ
[5-amino-1-(2-methyl-1H-benzimidazol-6-yl)-1H-pyrazol-4-yl](1H-indol-2-yl)methanone
Find entries where: LWJ
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | [5-amino-1-(2-methyl-1H-benzimidazol-6-yl)-1H-pyrazol-4-yl](1H-indol-2-yl)methanone |
| Identifiers | [5-azanyl-1-(2-methyl-3H-benzimidazol-5-yl)pyrazol-4-yl]-(1H-indol-2-yl)methanone |
| Formula | C20 H16 N6 O |
| Molecular Weight | 356.381 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1[nH]c2cc(ccc2n1)n3c(c(cn3)C(=O)c4cc5ccccc5[nH]4)N |
| InChI | InChI=1S/C20H16N6O/c1-11-23-16-7-6-13(9-17(16)24-11)26-20(21)14(10-22-26)19(27)18-8-12-4-2-3-5-15(12)25-18/h2-10,25H,21H2,1H3,(H,23,24) |
| InChIKey | BEMNJULZEQTDJY-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 43 |
| Chiral Atom Count | 0 |
| Bond Count | 47 |
| Aromatic Bond Count | 25 |
Drug Info: DrugBank
| DrugBank ID | DB12903 |
|---|---|
| Name | DEBIO-1347 |
| Groups | investigational |
| Description | Ch5183284 has been used in trials studying the treatment of Solid Tumours. |
| Synonyms | DEBIO-1347 |
| Categories | Heterocyclic Compounds, Fused-Ring |
| CAS number | 1265229-25-1 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3907479 |
| PubChem | 66555680 |
| ChEMBL | CHEMBL3907479 |
