O6M
3-cyano-N-(3-cyano-4-methyl-1H-indol-7-yl)benzene-1-sulfonamide
Find entries where: O6M
is present as a standalone ligand in 2 entries
Chemical Component Summary | |
|---|---|
| Name | 3-cyano-N-(3-cyano-4-methyl-1H-indol-7-yl)benzene-1-sulfonamide |
| Identifiers | 3-cyano-~{N}-(3-cyano-4-methyl-1~{H}-indol-7-yl)benzenesulfonamide |
| Formula | C17 H12 N4 O2 S |
| Molecular Weight | 336.368 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1ccc(c2c1c(c[nH]2)C#N)NS(=O)(=O)c3cccc(c3)C#N |
| InChI | InChI=1S/C17H12N4O2S/c1-11-5-6-15(17-16(11)13(9-19)10-20-17)21-24(22,23)14-4-2-3-12(7-14)8-18/h2-7,10,20-21H,1H3 |
| InChIKey | LWGUASZLXHYWIV-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 36 |
| Chiral Atom Count | 0 |
| Bond Count | 38 |
| Aromatic Bond Count | 16 |
Drug Info: DrugBank
| DrugBank ID | DB12505 |
|---|---|
| Name | E-7820 |
| Groups | investigational |
| Description | E7820 has been investigated for the treatment of Colon Cancer and Rectal Cancer. |
| Synonyms | E-7820 |
| Categories |
|
| CAS number | 289483-69-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 196970 |
| ChEMBL | CHEMBL4297376 |
