PRD_002214
PRD_002214 is described in the Biologically Interesting Molecule Reference Dictionary (BIRD).
The representative PDB ID is 5EU8.
Chemical Component Summary | |
|---|---|
| Name | n/a |
| Identifiers | (phenylmethyl) (4~{S})-4-[[(2~{S})-4-methyl-2-[[(2~{S})-3-methyl-2-[[(2~{S})-2-[(5-methyl-1,2-oxazol-3-yl)carbonylamino]propanoyl]amino]butanoyl]amino]pentanoyl]amino]-5-[(3~{S})-2-oxidanylidenepyrrolidin-3-yl]pent-2-enoate |
| Formula | C35 H48 N6 O8 |
| Molecular Weight | 680.79 |
| Type | PEPTIDE-LIKE |
| Isomeric SMILES | Cc1cc(no1)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C[C@@H]2CCNC2=O)C=CC(=O)OCc3ccccc3 |
| InChI | n/a |
| InChIKey | n/a |
| Composition | Polymer Sequences: 02J|ALA|VAL|LEU|PJE|010 Non-Polymer Components: n/a |
| BIRD class | INHIBITOR |
| Represented As | POLYMER |
| Compound Details | n/a |
| Description | n/a |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 97 |
| Chiral Atom Count | 5 |
| Bond Count | 99 |
| Aromatic Bond Count | 11 |
