RLJ
(2S)-3-(4-cyanophenoxy)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide
Find entries where: RLJ
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | (2S)-3-(4-cyanophenoxy)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide |
| Identifiers | (2S)-3-(4-cyanophenoxy)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-2-oxidanyl-propanamide |
| Formula | C19 H14 F3 N3 O3 |
| Molecular Weight | 389.328 |
| Type | NON-POLYMER |
| Isomeric SMILES | C[C@](COc1ccc(cc1)C#N)(C(=O)Nc2ccc(c(c2)C(F)(F)F)C#N)O |
| InChI | InChI=1S/C19H14F3N3O3/c1-18(27,11-28-15-6-2-12(9-23)3-7-15)17(26)25-14-5-4-13(10-24)16(8-14)19(20,21)22/h2-8,27H,11H2,1H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | JNGVJMBLXIUVRD-SFHVURJKSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 42 |
| Chiral Atom Count | 1 |
| Bond Count | 43 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB12078 |
|---|---|
| Name | Enobosarm |
| Groups | investigational |
| Description | Enobosarm has been used in trials studying the treatment of Stress Urinary Incontinence and Triple Negative Breast Cancer. |
| Synonyms |
|
| Categories |
|
| CAS number | 841205-47-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL1738889 |
| PubChem | 11326715 |
| ChEMBL | CHEMBL1738889 |
