VRD
({3-[amino(oxo)acetyl]-1-benzyl-2-ethyl-1H-indol-4-yl}oxy)acetic acid
Find entries where: VRD
is present as a standalone ligand in 3 entries
Chemical Component Summary | |
|---|---|
| Name | ({3-[amino(oxo)acetyl]-1-benzyl-2-ethyl-1H-indol-4-yl}oxy)acetic acid |
| Synonyms | Varespladib |
| Identifiers | 2-[2-ethyl-3-oxamoyl-1-(phenylmethyl)indol-4-yl]oxyethanoic acid |
| Formula | C21 H20 N2 O5 |
| Molecular Weight | 380.394 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCc1c(c2c(n1Cc3ccccc3)cccc2OCC(=O)O)C(=O)C(=O)N |
| InChI | InChI=1S/C21H20N2O5/c1-2-14-19(20(26)21(22)27)18-15(9-6-10-16(18)28-12-17(24)25)23(14)11-13-7-4-3-5-8-13/h3-10H,2,11-12H2,1H3,(H2,22,27)(H,24,25) |
| InChIKey | BHLXTPHDSZUFHR-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 48 |
| Chiral Atom Count | 0 |
| Bond Count | 50 |
| Aromatic Bond Count | 16 |
Drug Info: DrugBank
| DrugBank ID | DB11909 |
|---|---|
| Name | Varespladib |
| Groups | investigational |
| Description | Varespladib has been investigated for the treatment and prevention of Sickle Cell Disease, Vaso-occlusive Crisis, and Acute Coronary Syndrome. |
| Synonyms |
|
| Categories |
|
| CAS number | 172732-68-2 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL148674 |
| PubChem | 155815 |
| ChEMBL | CHEMBL148674 |
