DTT
2,3-DIHYDROXY-1,4-DITHIOBUTANE
DTT is found in 187 entries
DTT as free ligands, exist in 187 entries. Example includes: 4KMD 4DLY 4U9O
Find related ligands: Stereoisomers Similar ligands Chemical Structure Search
Chemical Component Summary | |
|---|---|
| Name | 2,3-DIHYDROXY-1,4-DITHIOBUTANE |
| Identifiers | (2R,3R)-1,4-bis-sulfanylbutane-2,3-diol |
| Formula | C4 H10 O2 S2 |
| Molecular Weight | 154.25 g/mol |
| Type | NON-POLYMER |
| Isomeric SMILES | O[C@@H](CS)[C@@H](O)CS |
| InChI | InChI=1S/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | VHJLVAABSRFDPM-IMJSIDKUSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 18 |
| Chiral Atom Count | 2 |
| Chiral Atoms | C2 C3 |
| Bond Count | 17 |
| Aromatic Bond Count | 0 |
| Leaving Atoms | n/a |
Drug Info: DrugBank
| DrugBank ID | DB04447 Stereoisomeric match |
|---|---|
| Name | 1,4-Dithiothreitol |
| Groups | experimental |
| Description | A reagent commonly used in biochemical studies as a protective agent to prevent the oxidation of SH (thiol) groups and for reducing disulphides to dithiols. [PubChem] |
| Synonyms | 2,3-dihydroxy-1,4-dithiobutane |
| CAS number | 3483-12-3 |
Drug Targets
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
