Chemical Component Summary

Name[(1R)-1-amino-4-methoxybutyl]boronic acid
Identifiers[(1R)-1-azanyl-4-methoxy-butyl]boronic acid
FormulaC5 H14 B N O3
Molecular Weight146.98
TypePEPTIDE-LIKE
Isomeric SMILESB([C@H](CCCOC)N)(O)O
InChIInChI=1S/C5H14BNO3/c1-10-4-2-3-5(7)6(8)9/h5,8-9H,2-4,7H2,1H3/t5-/m0/s1
InChIKeyHSZIJAHUOVGOAM-YFKPBYRVSA-N

Chemical Details

Formal Charge0
Atom Count24
Chiral Atom Count1
Bond Count23
Aromatic Bond Count0