353
N-{4-[(2-amino-3-chloropyridin-4-yl)oxy]-3-fluorophenyl}-4-ethoxy-1-(4-fluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxamide
Find entries where: 353
is present as a standalone ligand in 2 entries
Chemical Component Summary | |
|---|---|
| Name | N-{4-[(2-amino-3-chloropyridin-4-yl)oxy]-3-fluorophenyl}-4-ethoxy-1-(4-fluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxamide |
| Identifiers | N-[4-(2-amino-3-chloro-pyridin-4-yl)oxy-3-fluoro-phenyl]-4-ethoxy-1-(4-fluorophenyl)-2-oxo-pyridine-3-carboxamide |
| Formula | C25 H19 Cl F2 N4 O4 |
| Molecular Weight | 512.893 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCOC1=C(C(=O)N(C=C1)c2ccc(cc2)F)C(=O)Nc3ccc(c(c3)F)Oc4ccnc(c4Cl)N |
| InChI | InChI=1S/C25H19ClF2N4O4/c1-2-35-19-10-12-32(16-6-3-14(27)4-7-16)25(34)21(19)24(33)31-15-5-8-18(17(28)13-15)36-20-9-11-30-23(29)22(20)26/h3-13H,2H2,1H3,(H2,29,30)(H,31,33) |
| InChIKey | VNBRGSXVFBYQNN-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 55 |
| Chiral Atom Count | 0 |
| Bond Count | 58 |
| Aromatic Bond Count | 18 |
Drug Info: DrugBank
| DrugBank ID | DB12064 |
|---|---|
| Name | BMS-777607 |
| Groups | investigational |
| Description | BMS-777607 has been investigated for the basic science of Malignant Solid Tumour. |
| Synonyms | BMS-777607 |
| Categories |
|
| CAS number | 1025720-94-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL460702 |
| PubChem | 24794418 |
| ChEMBL | CHEMBL460702 |
| ChEBI | CHEBI:91409 |
