FPM
(5R,6S)-6-(1-hydroxyethyl)-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid
Find entries where: FPM
is present as a standalone ligand in 2 entries
Chemical Component Summary | |
|---|---|
| Name | (5R,6S)-6-(1-hydroxyethyl)-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| Synonyms | Faropenem |
| Identifiers | (5R,6S)-6-(1-hydroxyethyl)-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| Formula | C12 H15 N O5 S |
| Molecular Weight | 285.316 |
| Type | NON-POLYMER |
| Isomeric SMILES | C[C@H]([C@@H]1[C@@H]2N(C1=O)C(=C(S2)[C@H]3CCCO3)C(=O)O)O |
| InChI | InChI=1S/C12H15NO5S/c1-5(14)7-10(15)13-8(12(16)17)9(19-11(7)13)6-3-2-4-18-6/h5-7,11,14H,2-4H2,1H3,(H,16,17)/t5-,6-,7+,11-/m1/s1 |
| InChIKey | HGGAKXAHAYOLDJ-FHZUQPTBSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 34 |
| Chiral Atom Count | 4 |
| Bond Count | 36 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB12190 |
|---|---|
| Name | Faropenem |
| Groups | investigational |
| Description | Faropenem has been used in trials studying the treatment of Tuberculosis, Pulmonary Tuberculosis, and Community Acquired Pneumonia. |
| Synonyms |
|
| Categories |
|
| ATC-Code | J01DI03 |
| CAS number | 106560-14-9 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 65894 |
| ChEMBL | CHEMBL556262 |
| ChEBI | CHEBI:51257 |
