Chemical Component Summary | |
|---|---|
| Name | golvatinib |
| Identifiers | ~{N}1'-[2-fluoranyl-4-[2-[[4-(4-methylpiperazin-1-yl)piperidin-1-yl]carbonylamino]pyridin-4-yl]oxy-phenyl]-~{N}1-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| Formula | C33 H37 F2 N7 O4 |
| Molecular Weight | 633.688 |
| Type | NON-POLYMER |
| Isomeric SMILES | CN1CCN(CC1)C2CCN(CC2)C(=O)Nc3cc(ccn3)Oc4ccc(c(c4)F)NC(=O)C5(CC5)C(=O)Nc6ccc(cc6)F |
| InChI | InChI=1S/C33H37F2N7O4/c1-40-16-18-41(19-17-40)24-9-14-42(15-10-24)32(45)39-29-21-26(8-13-36-29)46-25-6-7-28(27(35)20-25)38-31(44)33(11-12-33)30(43)37-23-4-2-22(34)3-5-23/h2-8,13,20-21,24H,9-12,14-19H2,1H3,(H,37,43)(H,38,44)(H,36,39,45) |
| InChIKey | UQRCJCNVNUFYDX-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 83 |
| Chiral Atom Count | 0 |
| Bond Count | 88 |
| Aromatic Bond Count | 18 |
Drug Info: DrugBank
| DrugBank ID | DB11977 |
|---|---|
| Name | Golvatinib |
| Groups | investigational |
| Description | Golvatinib has been investigated for the treatment of Platinum-Resistant Squamous Cell Carcinoma of the Head and Neck. |
| Synonyms |
|
| Categories |
|
| CAS number | 928037-13-2 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3039525 |
| PubChem | 16118392 |
| ChEMBL | CHEMBL3039525 |
