JAL
4-chloranyl-2-[(5-chloranyl-2-oxidanyl-phenyl)methyl]phenol
Find entries where: JAL
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 4-chloranyl-2-[(5-chloranyl-2-oxidanyl-phenyl)methyl]phenol |
| Synonyms | Dichlorophen |
| Identifiers | 4-chloranyl-2-[(5-chloranyl-2-oxidanyl-phenyl)methyl]phenol |
| Formula | C13 H10 Cl2 O2 |
| Molecular Weight | 269.123 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1cc(c(cc1Cl)Cc2cc(ccc2O)Cl)O |
| InChI | InChI=1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2 |
| InChIKey | MDNWOSOZYLHTCG-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 27 |
| Chiral Atom Count | 0 |
| Bond Count | 28 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB11396 |
|---|---|
| Name | Dichlorophen |
| Groups |
|
| Description | Dichlorophen is an antimicrobial agent shown to exert activity against cestodes, protozoa, fungi, and bacteria. It is often combined with toluene to remove parasites including ascarids, tapeworm, and hookworm from dogs and cats. |
| Synonyms |
|
| Categories |
|
| ATC-Code | P02DX02 |
| CAS number | 97-23-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 3037 |
| ChEMBL | CHEMBL33845 |
| ChEBI | CHEBI:34689 |
| CCDC/CSD | ZZZJKK01 |
