Chemical Component Summary | |
|---|---|
| Name | Prinomastat |
| Synonyms | (3S)-N-hydroxy-2,2-dimethyl-4-{[4-(pyridin-4-yloxy)phenyl]sulfonyl}thiomorpholine-3-carboxamide |
| Identifiers | (3S)-N-hydroxy-2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonyl-thiomorpholine-3-carboxamide |
| Formula | C18 H21 N3 O5 S2 |
| Molecular Weight | 423.506 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC1([C@@H](N(CCS1)S(=O)(=O)c2ccc(cc2)Oc3ccncc3)C(=O)NO)C |
| InChI | InChI=1S/C18H21N3O5S2/c1-18(2)16(17(22)20-23)21(11-12-27-18)28(24,25)15-5-3-13(4-6-15)26-14-7-9-19-10-8-14/h3-10,16,23H,11-12H2,1-2H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | YKPYIPVDTNNYCN-INIZCTEOSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 49 |
| Chiral Atom Count | 1 |
| Bond Count | 51 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB05100 |
|---|---|
| Name | Prinomastat |
| Groups | investigational |
| Description | Prinomastat is a synthetic hydroxamic acid derivative with potential antineoplastic activity. Prinomastat inhibits matrix metalloproteinases (MMPs) (specifically, MMP-2, 9, 13, and 14), thereby inducing extracellular matrix degradation, and inhibiting angiogenesis, tumor growth and invasion, and metastasis. As a lipophilic agent, prinomastat crosses the blood-brain barrier. |
| Synonyms |
|
| Indication | Investigated for use/treatment in brain cancer, lung cancer, and prostate cancer. |
| Categories |
|
| CAS number | 192329-42-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL75094 |
| PubChem | 466151 |
| ChEMBL | CHEMBL75094 |
| ChEBI | CHEBI:138885 |
