SI3
5-(acetylamino)-3,5-dideoxy-D-glycero-D-galacto-non-2-ulosonic acid
Find entries where: SI3
is present as a standalone ligand in 2 entries
as a non-polymer is covalently linked to polymer or other heterogen groups 1 entries
Chemical Component Summary | |
|---|---|
| Name | 5-(acetylamino)-3,5-dideoxy-D-glycero-D-galacto-non-2-ulosonic acid |
| Synonyms | N-acetylneuraminic acid, ketone form |
| Identifiers | (4S,5R,6R,7S,8R)-5-acetamido-4,6,7,8,9-pentakis(oxidanyl)-2-oxidanylidene-nonanoic acid |
| Formula | C11 H19 N O9 |
| Molecular Weight | 309.27 |
| Type | D-SACCHARIDE |
| Isomeric SMILES | CC(=O)N[C@H]([C@H](CC(=O)C(=O)O)O)[C@H]([C@@H]([C@@H](CO)O)O)O |
| InChI | InChI=1S/C11H19NO9/c1-4(14)12-8(5(15)2-6(16)11(20)21)10(19)9(18)7(17)3-13/h5,7-10,13,15,17-19H,2-3H2,1H3,(H,12,14)(H,20,21)/t5-,7+,8+,9+,10+/m0/s1 |
| InChIKey | KBGAYAKRZNYFFG-BOHATCBPSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 40 |
| Chiral Atom Count | 5 |
| Bond Count | 39 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB11797 |
|---|---|
| Name | Aceneuramic acid |
| Groups | investigational |
| Description | Aceneuramic acid has been used in trials studying the treatment of Distal Myopathy, Nonaka Type, Hereditary Inclusion Body Myopathy, and Distal Myopathy With Rimmed Vacuoles. |
| Synonyms |
|
| Categories | Musculo-Skeletal System |
| ATC-Code | M09AX05 |
| CAS number | 131-48-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 14017587 |
| ChEMBL | CHEMBL2105945 |
