Chemical Component Summary | |
|---|---|
| Name | volitinib |
| Identifiers | 3-[(1~{S})-1-imidazo[1,2-a]pyridin-6-ylethyl]-5-(1-methylpyrazol-4-yl)-[1,2,3]triazolo[4,5-b]pyrazine |
| Formula | C17 H15 N9 |
| Molecular Weight | 345.361 |
| Type | NON-POLYMER |
| Isomeric SMILES | C[C@@H](c1ccc2nccn2c1)n3c4c(ncc(n4)c5cnn(c5)C)nn3 |
| InChI | InChI=1S/C17H15N9/c1-11(12-3-4-15-18-5-6-25(15)10-12)26-17-16(22-23-26)19-8-14(21-17)13-7-20-24(2)9-13/h3-11H,1-2H3/t11-/m0/s1 |
| InChIKey | XYDNMOZJKOGZLS-NSHDSACASA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 41 |
| Chiral Atom Count | 1 |
| Bond Count | 45 |
| Aromatic Bond Count | 25 |
Drug Info: DrugBank
| DrugBank ID | DB12048 |
|---|---|
| Name | Savolitinib |
| Groups | investigational |
| Description | Savolitinib has been used in trials studying the treatment and health services research of Tumor, Food Effect, Gastric Cancer, Health Subjects, and Colorectal Cancer, among others. |
| Synonyms |
|
| Categories | Tyrosine Kinase Inhibitors |
| CAS number | 1313725-88-0 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3334567 |
| PubChem | 68289010 |
| ChEMBL | CHEMBL3334567 |
